C9H19NO — CID 166967551
N,N-diethyl-4-methoxybut-1-en-2-amine (PubChem CID 166967551) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is N,N-diethyl-4-methoxybut-1-en-2-amine.
| Compound Name | N,N-diethyl-4-methoxybut-1-en-2-amine |
|---|---|
| PubChem CID | 166967551 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | N,N-diethyl-4-methoxybut-1-en-2-amine |
| SMILES | C=C(CCOC)N(CC)CC |
| InChI | InChI=1S/C9H19NO/c1-5-10(6-2)9(3)7-8-11-4/h3,5-8H2,1-2,4H3 |
| InChIKey | XHGOROWDLYMHSC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |