C21H26N6 — CID 166967993
1-[(3S,4R)-1-benzyl-4-propan-2-ylpyrrolidine-3-carboximidoyl]-5H-pyrrolo[2,3-b]pyrazin-2-imine (PubChem CID 166967993) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is 1-[(3S,4R)-1-benzyl-4-propan-2-ylpyrrolidine-3-carboximidoyl]-5H-pyrrolo[2,3-b]pyrazin-2-imine.
| Compound Name | 1-[(3S,4R)-1-benzyl-4-propan-2-ylpyrrolidine-3-carboximidoyl]-5H-pyrrolo[2,3-b]pyrazin-2-imine |
|---|---|
| PubChem CID | 166967993 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 1-[(3S,4R)-1-benzyl-4-propan-2-ylpyrrolidine-3-carboximidoyl]-5H-pyrrolo[2,3-b]pyrazin-2-imine |
| SMILES | [H]/N=C(\[C@@H]1CN(Cc2ccccc2)C[C@@H]1C(C)C)n1/c(=N/[H])cnc2[nH]ccc21 |
| InChI | InChI=1S/C21H26N6/c1-14(2)16-12-26(11-15-6-4-3-5-7-15)13-17(16)20(23)27-18-8-9-24-21(18)25-10-19(27)22/h3-10,14,16-17,22-24H,11-13H2,1-2H3/b22-19+,23-20+/t16-,17-/m1/s1 |
| InChIKey | VTCHGUNIKWLFIF-QSCSVAOHSA-N |
| XLogP | 3.07 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|