C54H104N2O6 — CID 166970045
bis(3-pentyloctyl) 9-methyl-9-[2-[3-(4-methylpiperazin-1-yl)propoxy]-2-oxoethyl]heptadecanedioate (PubChem CID 166970045) has the molecular formula C54H104N2O6 and a molecular weight of 877.43 g/mol. Its IUPAC name is bis(3-pentyloctyl) 9-methyl-9-[2-[3-(4-methylpiperazin-1-yl)propoxy]-2-oxoethyl]heptadecanedioate.
| Compound Name | bis(3-pentyloctyl) 9-methyl-9-[2-[3-(4-methylpiperazin-1-yl)propoxy]-2-oxoethyl]heptadecanedioate |
|---|---|
| PubChem CID | 166970045 |
| Molecular Formula | C54H104N2O6 |
| Molecular Weight | 877.43 g/mol |
| Exact Mass | 876.79 |
| IUPAC Name | bis(3-pentyloctyl) 9-methyl-9-[2-[3-(4-methylpiperazin-1-yl)propoxy]-2-oxoethyl]heptadecanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCCCCCCC(C)(CCCCCCCC(=O)OCCC(CCCCC)CCCCC)CC(=O)OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C54H104N2O6/c1-7-11-21-30-49(31-22-12-8-2)36-46-61-51(57)34-25-17-15-19-27-38-54(5,48-53(59)60-45-29-40-56-43-41-55(6)42-44-56)39-28-20-16-18-26-35-52(58)62-47-37-50(32-23-13-9-3)33-24-14-10-4/h49-50H,7-48H2,1-6H3 |
| InChIKey | JRZYRYPXNMDVDT-UHFFFAOYSA-N |
| XLogP | 14.45 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.43 |
| LogP ≤ 5 | 14.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|