C13H25NO2 — CID 166970989
6-amino-2,2,9-trimethyldecane-3,7-dione (PubChem CID 166970989) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is 6-amino-2,2,9-trimethyldecane-3,7-dione.
| Compound Name | 6-amino-2,2,9-trimethyldecane-3,7-dione |
|---|---|
| PubChem CID | 166970989 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | 6-amino-2,2,9-trimethyldecane-3,7-dione |
| SMILES | CC(C)CC(=O)C(N)CCC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO2/c1-9(2)8-11(15)10(14)6-7-12(16)13(3,4)5/h9-10H,6-8,14H2,1-5H3 |
| InChIKey | HLTYRQFCBWQJFO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |