C23H23FN4O — CID 166971823
6-[3-[1-[(1R,2S,5R)-5-ethyl-2-fluoro-5-methylcyclohex-3-en-1-yl]ethenyl]-1,2,4-triazin-6-yl]isoquinolin-7-ol (PubChem CID 166971823) has the molecular formula C23H23FN4O and a molecular weight of 390.46 g/mol. Its IUPAC name is 6-[3-[1-[(1R,2S,5R)-5-ethyl-2-fluoro-5-methylcyclohex-3-en-1-yl]ethenyl]-1,2,4-triazin-6-yl]isoquinolin-7-ol.
| Compound Name | 6-[3-[1-[(1R,2S,5R)-5-ethyl-2-fluoro-5-methylcyclohex-3-en-1-yl]ethenyl]-1,2,4-triazin-6-yl]isoquinolin-7-ol |
|---|---|
| PubChem CID | 166971823 |
| Molecular Formula | C23H23FN4O |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 6-[3-[1-[(1R,2S,5R)-5-ethyl-2-fluoro-5-methylcyclohex-3-en-1-yl]ethenyl]-1,2,4-triazin-6-yl]isoquinolin-7-ol |
| SMILES | C=C(c1ncc(-c2cc3ccncc3cc2O)nn1)[C@H]1C[C@@](C)(CC)C=C[C@@H]1F |
| InChI | InChI=1S/C23H23FN4O/c1-4-23(3)7-5-19(24)18(11-23)14(2)22-26-13-20(27-28-22)17-9-15-6-8-25-12-16(15)10-21(17)29/h5-10,12-13,18-19,29H,2,4,11H2,1,3H3/t18-,19+,23+/m1/s1 |
| InChIKey | NVEUVPWZTXRNHZ-MSYCTHLASA-N |
| XLogP | 5.14 |
| TPSA | 71.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|