C30H37N9O — CID 166973164
1-N-[2-(dimethylamino)ethyl]-4-N-[4-(3,3-dimethyl-6-phenyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine (PubChem CID 166973164) has the molecular formula C30H37N9O and a molecular weight of 539.69 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-4-N-[4-(3,3-dimethyl-6-phenyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-4-N-[4-(3,3-dimethyl-6-phenyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine |
|---|---|
| PubChem CID | 166973164 |
| Molecular Formula | C30H37N9O |
| Molecular Weight | 539.69 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-4-N-[4-(3,3-dimethyl-6-phenyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]-5-methoxy-1-N-methylbenzene-1,2,4-triamine |
| SMILES | COc1cc(N(C)CCN(C)C)c(N)cc1Nc1ncnc(N2CC(C)(C)c3ncc(-c4ccccc4)cc32)n1 |
| InChI | InChI=1S/C30H37N9O/c1-30(2)18-39(25-14-21(17-32-27(25)30)20-10-8-7-9-11-20)29-34-19-33-28(36-29)35-23-15-22(31)24(16-26(23)40-6)38(5)13-12-37(3)4/h7-11,14-17,19H,12-13,18,31H2,1-6H3,(H,33,34,35,36) |
| InChIKey | SJXCNPMKXLUEHC-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|