C32H43N9O3 — CID 174107166
3-[2-[2-(dimethylamino)ethyl-methylamino]-4-propan-2-yloxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-formylprop-2-enamide (PubChem CID 174107166) has the molecular formula C32H43N9O3 and a molecular weight of 601.76 g/mol. Its IUPAC name is 3-[2-[2-(dimethylamino)ethyl-methylamino]-4-propan-2-yloxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-formylprop-2-enamide.
| Compound Name | 3-[2-[2-(dimethylamino)ethyl-methylamino]-4-propan-2-yloxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-formylprop-2-enamide |
|---|---|
| PubChem CID | 174107166 |
| Molecular Formula | C32H43N9O3 |
| Molecular Weight | 601.76 g/mol |
| Exact Mass | 601.35 |
| IUPAC Name | 3-[2-[2-(dimethylamino)ethyl-methylamino]-4-propan-2-yloxy-5-[[4-(3,3,5,6-tetramethyl-2H-pyrrolo[3,2-b]pyridin-1-yl)-1,3,5-triazin-2-yl]amino]phenyl]-N-formylprop-2-enamide |
| SMILES | Cc1cc2c(nc1C)C(C)(C)CN2c1ncnc(Nc2cc(C=CC(=O)NC=O)c(N(C)CCN(C)C)cc2OC(C)C)n1 |
| InChI | InChI=1S/C32H43N9O3/c1-20(2)44-27-16-25(40(9)13-12-39(7)8)23(10-11-28(43)35-19-42)15-24(27)37-30-33-18-34-31(38-30)41-17-32(5,6)29-26(41)14-21(3)22(4)36-29/h10-11,14-16,18-20H,12-13,17H2,1-9H3,(H,35,42,43)(H,33,34,37,38) |
| InChIKey | AABYHJFXYHXMCS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|