C20H35N3O4 — CID 166975006
(E)-5-methyl-4-oxo-N-[3-oxo-4-[[3-oxo-4-(propylamino)pentyl]amino]pentyl]hex-2-enamide (PubChem CID 166975006) has the molecular formula C20H35N3O4 and a molecular weight of 381.52 g/mol. Its IUPAC name is (E)-5-methyl-4-oxo-N-[3-oxo-4-[[3-oxo-4-(propylamino)pentyl]amino]pentyl]hex-2-enamide.
| Compound Name | (E)-5-methyl-4-oxo-N-[3-oxo-4-[[3-oxo-4-(propylamino)pentyl]amino]pentyl]hex-2-enamide |
|---|---|
| PubChem CID | 166975006 |
| Molecular Formula | C20H35N3O4 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.26 |
| IUPAC Name | (E)-5-methyl-4-oxo-N-[3-oxo-4-[[3-oxo-4-(propylamino)pentyl]amino]pentyl]hex-2-enamide |
| SMILES | CCCNC(C)C(=O)CCNC(C)C(=O)CCNC(=O)/C=C/C(=O)C(C)C |
| InChI | InChI=1S/C20H35N3O4/c1-6-11-21-15(4)18(25)9-12-22-16(5)19(26)10-13-23-20(27)8-7-17(24)14(2)3/h7-8,14-16,21-22H,6,9-13H2,1-5H3,(H,23,27)/b8-7+ |
| InChIKey | AFNOEAWYYPBYTK-BQYQJAHWSA-N |
| XLogP | 1.17 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|