C19H35N3O3 — CID 174154554
(Z)-5-methyl-N-[3-[[4-(2-methylpropylamino)-3-oxopentyl]amino]propyl]-4-oxohex-2-enamide (PubChem CID 174154554) has the molecular formula C19H35N3O3 and a molecular weight of 353.51 g/mol. Its IUPAC name is (Z)-5-methyl-N-[3-[[4-(2-methylpropylamino)-3-oxopentyl]amino]propyl]-4-oxohex-2-enamide.
| Compound Name | (Z)-5-methyl-N-[3-[[4-(2-methylpropylamino)-3-oxopentyl]amino]propyl]-4-oxohex-2-enamide |
|---|---|
| PubChem CID | 174154554 |
| Molecular Formula | C19H35N3O3 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | (Z)-5-methyl-N-[3-[[4-(2-methylpropylamino)-3-oxopentyl]amino]propyl]-4-oxohex-2-enamide |
| SMILES | CC(C)CNC(C)C(=O)CCNCCCNC(=O)/C=C\C(=O)C(C)C |
| InChI | InChI=1S/C19H35N3O3/c1-14(2)13-22-16(5)18(24)9-12-20-10-6-11-21-19(25)8-7-17(23)15(3)4/h7-8,14-16,20,22H,6,9-13H2,1-5H3,(H,21,25)/b8-7- |
| InChIKey | PSTFVPMFPPEYDY-FPLPWBNLSA-N |
| XLogP | 1.46 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|