C10H14FN — CID 166976443
N-buta-1,2-dienyl-3-fluoro-4-methylpent-3-en-2-imine (PubChem CID 166976443) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is N-buta-1,2-dienyl-3-fluoro-4-methylpent-3-en-2-imine.
| Compound Name | N-buta-1,2-dienyl-3-fluoro-4-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 166976443 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | N-buta-1,2-dienyl-3-fluoro-4-methylpent-3-en-2-imine |
| SMILES | CC=C=C/N=C(\C)C(F)=C(C)C |
| InChI | InChI=1S/C10H14FN/c1-5-6-7-12-9(4)10(11)8(2)3/h5,7H,1-4H3/b12-9+ |
| InChIKey | CIXLTDWJXNUFTP-FMIVXFBMSA-N |
| XLogP | 3.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|