C32H33F4N3O3S — CID 166977197
3-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]hept-6-enyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 166977197) has the molecular formula C32H33F4N3O3S and a molecular weight of 615.69 g/mol. Its IUPAC name is 3-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]hept-6-enyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | 3-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]hept-6-enyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 166977197 |
| Molecular Formula | C32H33F4N3O3S |
| Molecular Weight | 615.69 g/mol |
| Exact Mass | 615.22 |
| IUPAC Name | 3-fluoro-N-[3-[4-(methanesulfonamido)phenyl]phenyl]-N-[5-[5-(trifluoromethyl)-2-pyridinyl]hept-6-enyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | C=CC(CCCCN(C(=O)C12CC(F)(C1)C2)c1cccc(-c2ccc(NS(C)(=O)=O)cc2)c1)c1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C32H33F4N3O3S/c1-3-22(28-15-12-25(18-37-28)32(34,35)36)7-4-5-16-39(29(40)30-19-31(33,20-30)21-30)27-9-6-8-24(17-27)23-10-13-26(14-11-23)38-43(2,41)42/h3,6,8-15,17-18,22,38H,1,4-5,7,16,19-21H2,2H3 |
| InChIKey | FCZXOPFXOBIGME-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.69 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|