C14H19ClN2O — CID 166981483
6-chloro-2-[[cyclohexyl(methyl)amino]methyl]pyridine-3-carbaldehyde (PubChem CID 166981483) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 6-chloro-2-[[cyclohexyl(methyl)amino]methyl]pyridine-3-carbaldehyde.
| Compound Name | 6-chloro-2-[[cyclohexyl(methyl)amino]methyl]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 166981483 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-chloro-2-[[cyclohexyl(methyl)amino]methyl]pyridine-3-carbaldehyde |
| SMILES | CN(Cc1nc(Cl)ccc1C=O)C1CCCCC1 |
| InChI | InChI=1S/C14H19ClN2O/c1-17(12-5-3-2-4-6-12)9-13-11(10-18)7-8-14(15)16-13/h7-8,10,12H,2-6,9H2,1H3 |
| InChIKey | HOLPKAWYNIFXHS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|