C13H14BrF3N2O3S — CID 166981835
4-bromo-2-(methanesulfonamido)-N-(5,5,5-trifluoropent-1-en-2-yl)benzamide (PubChem CID 166981835) has the molecular formula C13H14BrF3N2O3S and a molecular weight of 415.23 g/mol. Its IUPAC name is 4-bromo-2-(methanesulfonamido)-N-(5,5,5-trifluoropent-1-en-2-yl)benzamide.
| Compound Name | 4-bromo-2-(methanesulfonamido)-N-(5,5,5-trifluoropent-1-en-2-yl)benzamide |
|---|---|
| PubChem CID | 166981835 |
| Molecular Formula | C13H14BrF3N2O3S |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | 4-bromo-2-(methanesulfonamido)-N-(5,5,5-trifluoropent-1-en-2-yl)benzamide |
| SMILES | C=C(CCC(F)(F)F)NC(=O)c1ccc(Br)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C13H14BrF3N2O3S/c1-8(5-6-13(15,16)17)18-12(20)10-4-3-9(14)7-11(10)19-23(2,21)22/h3-4,7,19H,1,5-6H2,2H3,(H,18,20) |
| InChIKey | TTZZEEVXRZUVJR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |