C24H20ClN5O — CID 166984544
1-[(4-chlorophenyl)methyl]-N-[(2-methylindazol-6-yl)methyl]indazole-3-carboxamide (PubChem CID 166984544) has the molecular formula C24H20ClN5O and a molecular weight of 429.91 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-[(2-methylindazol-6-yl)methyl]indazole-3-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-[(2-methylindazol-6-yl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 166984544 |
| Molecular Formula | C24H20ClN5O |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-[(2-methylindazol-6-yl)methyl]indazole-3-carboxamide |
| SMILES | Cn1cc2ccc(CNC(=O)c3nn(Cc4ccc(Cl)cc4)c4ccccc34)cc2n1 |
| InChI | InChI=1S/C24H20ClN5O/c1-29-15-18-9-6-17(12-21(18)27-29)13-26-24(31)23-20-4-2-3-5-22(20)30(28-23)14-16-7-10-19(25)11-8-16/h2-12,15H,13-14H2,1H3,(H,26,31) |
| InChIKey | QYOFWNXZLFHPHD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |