C25H20ClN3O2 — CID 166984699
N-[2-(1-benzofuran-3-yl)ethyl]-1-[(4-chlorophenyl)methyl]indazole-3-carboxamide (PubChem CID 166984699) has the molecular formula C25H20ClN3O2 and a molecular weight of 429.91 g/mol. Its IUPAC name is N-[2-(1-benzofuran-3-yl)ethyl]-1-[(4-chlorophenyl)methyl]indazole-3-carboxamide.
| Compound Name | N-[2-(1-benzofuran-3-yl)ethyl]-1-[(4-chlorophenyl)methyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 166984699 |
| Molecular Formula | C25H20ClN3O2 |
| Molecular Weight | 429.91 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | N-[2-(1-benzofuran-3-yl)ethyl]-1-[(4-chlorophenyl)methyl]indazole-3-carboxamide |
| SMILES | O=C(NCCc1coc2ccccc12)c1nn(Cc2ccc(Cl)cc2)c2ccccc12 |
| InChI | InChI=1S/C25H20ClN3O2/c26-19-11-9-17(10-12-19)15-29-22-7-3-1-6-21(22)24(28-29)25(30)27-14-13-18-16-31-23-8-4-2-5-20(18)23/h1-12,16H,13-15H2,(H,27,30) |
| InChIKey | SZHKQKAASXMALB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |