C26H23NO4 — CID 166987349
[5-(3-aminobenzoyl)oxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-methylbenzoate (PubChem CID 166987349) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is [5-(3-aminobenzoyl)oxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-methylbenzoate.
| Compound Name | [5-(3-aminobenzoyl)oxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 166987349 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [5-(3-aminobenzoyl)oxy-4-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2cc3c(cc2OC(=O)c2cccc(N)c2)C2CCC3C2)c1 |
| InChI | InChI=1S/C26H23NO4/c1-15-4-2-5-18(10-15)25(28)30-23-13-21-16-8-9-17(11-16)22(21)14-24(23)31-26(29)19-6-3-7-20(27)12-19/h2-7,10,12-14,16-17H,8-9,11,27H2,1H3 |
| InChIKey | UHUTXBSFUPOJLI-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|