C26H26O4 — CID 67394004
[8-(3-methylcyclohexanecarbonyl)oxynaphthalen-1-yl] 3-methylbenzoate (PubChem CID 67394004) has the molecular formula C26H26O4 and a molecular weight of 402.49 g/mol. Its IUPAC name is [8-(3-methylcyclohexanecarbonyl)oxynaphthalen-1-yl] 3-methylbenzoate.
| Compound Name | [8-(3-methylcyclohexanecarbonyl)oxynaphthalen-1-yl] 3-methylbenzoate |
|---|---|
| PubChem CID | 67394004 |
| Molecular Formula | C26H26O4 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [8-(3-methylcyclohexanecarbonyl)oxynaphthalen-1-yl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)Oc2cccc3cccc(OC(=O)C4CCCC(C)C4)c23)c1 |
| InChI | InChI=1S/C26H26O4/c1-17-7-3-11-20(15-17)25(27)29-22-13-5-9-19-10-6-14-23(24(19)22)30-26(28)21-12-4-8-18(2)16-21/h3,5-7,9-11,13-15,18,21H,4,8,12,16H2,1-2H3 |
| InChIKey | CZBGMUXUHMIGES-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|