About ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen
ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen (PubChem CID 160703508) has the molecular formula C20H32O4
and a molecular weight of 336.47 g/mol. Its IUPAC name is ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen.
Molecular Properties
| Compound Name | ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen |
| PubChem CID | 160703508 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen |
| SMILES | CCOC(=O)C1CCCC(C)C1.CCOC(=O)c1cccc(C)c1.[H][H] |
| InChI | InChI=1S/C10H18O2.C10H12O2.H2/c2*1-3-12-10(11)9-6-4-5-8(2)7-9;/h8-9H,3-7H2,1-2H3;4-7H,3H2,1-2H3;1H |
| InChIKey | RQXPIVJQBONLHV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen?
The IUPAC name of ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen (CID 160703508) is ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen.
What is the SMILES notation for ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen?
The canonical SMILES for ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen is CCOC(=O)C1CCCC(C)C1.CCOC(=O)c1cccc(C)c1.[H][H].
What is the InChIKey of ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen?
The InChIKey is RQXPIVJQBONLHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.C10H12O2.H2/c2*1-3-12-10(11)9-6-4-5-8(2)7-9;/h8-9H,3-7H2,1-2H3;4-7H,3H2,1-2H3;1H.
What are the key properties of ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen?
ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen has a molecular weight of 336.47 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-methylbenzoate;ethyl 3-methylcyclohexane-1-carboxylate;molecular hydrogen is sourced from PubChem (CID 160703508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).