C26H24O4 — CID 67394284
[8-(3-methylcyclohex-3-ene-1-carbonyl)oxynaphthalen-1-yl] 4-methylbenzoate (PubChem CID 67394284) has the molecular formula C26H24O4 and a molecular weight of 400.47 g/mol. Its IUPAC name is [8-(3-methylcyclohex-3-ene-1-carbonyl)oxynaphthalen-1-yl] 4-methylbenzoate.
| Compound Name | [8-(3-methylcyclohex-3-ene-1-carbonyl)oxynaphthalen-1-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 67394284 |
| Molecular Formula | C26H24O4 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | [8-(3-methylcyclohex-3-ene-1-carbonyl)oxynaphthalen-1-yl] 4-methylbenzoate |
| SMILES | CC1=CCCC(C(=O)Oc2cccc3cccc(OC(=O)c4ccc(C)cc4)c23)C1 |
| InChI | InChI=1S/C26H24O4/c1-17-12-14-20(15-13-17)25(27)29-22-10-4-7-19-8-5-11-23(24(19)22)30-26(28)21-9-3-6-18(2)16-21/h4-8,10-15,21H,3,9,16H2,1-2H3 |
| InChIKey | YAYJXRRIANZWGD-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|