C6H9FN2 — CID 166987577
[(1E,3Z)-1-fluoropenta-1,3-dienyl]-methyldiazene (PubChem CID 166987577) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is [(1E,3Z)-1-fluoropenta-1,3-dienyl]-methyldiazene.
| Compound Name | [(1E,3Z)-1-fluoropenta-1,3-dienyl]-methyldiazene |
|---|---|
| PubChem CID | 166987577 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | [(1E,3Z)-1-fluoropenta-1,3-dienyl]-methyldiazene |
| SMILES | C/C=C\C=C(F)/N=N/C |
| InChI | InChI=1S/C6H9FN2/c1-3-4-5-6(7)9-8-2/h3-5H,1-2H3/b4-3-,6-5-,9-8+ |
| InChIKey | WKHYHJRGYSYXOD-CPTVHZMHSA-N |
| XLogP | 2.46 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|