C37H38O6 — CID 166989093
[(5S,6R,7R,9S)-5,9-dimethoxy-8-methyl-6-(4-methylbenzoyl)oxy-5-(2-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-7-yl] 4-methylbenzoate (PubChem CID 166989093) has the molecular formula C37H38O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is [(5S,6R,7R,9S)-5,9-dimethoxy-8-methyl-6-(4-methylbenzoyl)oxy-5-(2-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-7-yl] 4-methylbenzoate.
| Compound Name | [(5S,6R,7R,9S)-5,9-dimethoxy-8-methyl-6-(4-methylbenzoyl)oxy-5-(2-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-7-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 166989093 |
| Molecular Formula | C37H38O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.27 |
| IUPAC Name | [(5S,6R,7R,9S)-5,9-dimethoxy-8-methyl-6-(4-methylbenzoyl)oxy-5-(2-methylphenyl)-6,7,8,9-tetrahydrobenzo[7]annulen-7-yl] 4-methylbenzoate |
| SMILES | CO[C@@H]1c2ccccc2[C@@](OC)(c2ccccc2C)[C@H](OC(=O)c2ccc(C)cc2)[C@H](OC(=O)c2ccc(C)cc2)C1C |
| InChI | InChI=1S/C37H38O6/c1-23-15-19-27(20-16-23)35(38)42-33-26(4)32(40-5)29-12-8-10-14-31(29)37(41-6,30-13-9-7-11-25(30)3)34(33)43-36(39)28-21-17-24(2)18-22-28/h7-22,26,32-34H,1-6H3/t26?,32-,33+,34+,37-/m0/s1 |
| InChIKey | ZVFGEXMGKCBGBW-QGDXTJMXSA-N |
| XLogP | 7.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |