C31H21IO4 — CID 170936773
[(1R,11S)-10-benzoyloxy-11-iodo-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate (PubChem CID 170936773) has the molecular formula C31H21IO4 and a molecular weight of 584.41 g/mol. Its IUPAC name is [(1R,11S)-10-benzoyloxy-11-iodo-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate.
| Compound Name | [(1R,11S)-10-benzoyloxy-11-iodo-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate |
|---|---|
| PubChem CID | 170936773 |
| Molecular Formula | C31H21IO4 |
| Molecular Weight | 584.41 g/mol |
| Exact Mass | 584.05 |
| IUPAC Name | [(1R,11S)-10-benzoyloxy-11-iodo-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate |
| SMILES | O=C(OC1C2c3ccccc3[C@@]23c2ccccc2[C@@]3(I)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H21IO4/c32-31-24-18-10-9-17-23(24)30(31)22-16-8-7-15-21(22)25(30)26(35-28(33)19-11-3-1-4-12-19)27(31)36-29(34)20-13-5-2-6-14-20/h1-18,25-27H/t25?,26?,27?,30-,31-/m1/s1 |
| InChIKey | GWDGJMUTPYEODY-CATRAHEQSA-N |
| XLogP | 6.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.41 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|