C30H21ClO4 — CID 170674204
(16-benzoyloxy-8-chloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl) benzoate (PubChem CID 170674204) has the molecular formula C30H21ClO4 and a molecular weight of 480.95 g/mol. Its IUPAC name is (16-benzoyloxy-8-chloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl) benzoate.
| Compound Name | (16-benzoyloxy-8-chloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl) benzoate |
|---|---|
| PubChem CID | 170674204 |
| Molecular Formula | C30H21ClO4 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | (16-benzoyloxy-8-chloro-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl) benzoate |
| SMILES | O=C(OC1C2c3ccccc3C(Cl)(c3ccccc32)C1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H21ClO4/c31-30-23-17-9-7-15-21(23)25(22-16-8-10-18-24(22)30)26(34-28(32)19-11-3-1-4-12-19)27(30)35-29(33)20-13-5-2-6-14-20/h1-18,25-27H |
| InChIKey | JMFASWUBYJPMAU-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|