C35H30O4 — CID 170936760
[(1R,11S)-10-benzoyloxy-13-butyl-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate (PubChem CID 170936760) has the molecular formula C35H30O4 and a molecular weight of 514.62 g/mol. Its IUPAC name is [(1R,11S)-10-benzoyloxy-13-butyl-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate.
| Compound Name | [(1R,11S)-10-benzoyloxy-13-butyl-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate |
|---|---|
| PubChem CID | 170936760 |
| Molecular Formula | C35H30O4 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | [(1R,11S)-10-benzoyloxy-13-butyl-9-pentacyclo[9.6.0.01,8.02,7.012,17]heptadeca-2,4,6,12,14,16-hexaenyl] benzoate |
| SMILES | CCCCc1cccc2c1[C@@H]1C(OC(=O)c3ccccc3)C(OC(=O)c3ccccc3)C3c4ccccc4[C@@]231 |
| InChI | InChI=1S/C35H30O4/c1-2-3-13-22-18-12-21-27-28(22)30-32(39-34(37)24-16-8-5-9-17-24)31(38-33(36)23-14-6-4-7-15-23)29-25-19-10-11-20-26(25)35(27,29)30/h4-12,14-21,29-32H,2-3,13H2,1H3/t29?,30-,31?,32?,35-/m1/s1 |
| InChIKey | WSFOZODMXGSPTC-GDFPFNTDSA-N |
| XLogP | 6.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |