C21H14ClF4NO4S — CID 166991403
6-(2-chloro-3,5-difluorophenyl)-4-[3-(difluoromethoxy)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 166991403) has the molecular formula C21H14ClF4NO4S and a molecular weight of 487.86 g/mol. Its IUPAC name is 6-(2-chloro-3,5-difluorophenyl)-4-[3-(difluoromethoxy)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 6-(2-chloro-3,5-difluorophenyl)-4-[3-(difluoromethoxy)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 166991403 |
| Molecular Formula | C21H14ClF4NO4S |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | 6-(2-chloro-3,5-difluorophenyl)-4-[3-(difluoromethoxy)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | O=S(=O)(c1cccc(OC(F)F)c1)N1CCOc2ccc(-c3cc(F)cc(F)c3Cl)cc21 |
| InChI | InChI=1S/C21H14ClF4NO4S/c22-20-16(9-13(23)10-17(20)24)12-4-5-19-18(8-12)27(6-7-30-19)32(28,29)15-3-1-2-14(11-15)31-21(25)26/h1-5,8-11,21H,6-7H2 |
| InChIKey | WXSQZRBYJIUMFP-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|