C18H19FN4O — CID 166992004
1-[3-(fluoromethyl)-5-(2-methylpyrimidin-5-yl)-2-(prop-2-enylamino)phenyl]-1-iminopropan-2-one (PubChem CID 166992004) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is 1-[3-(fluoromethyl)-5-(2-methylpyrimidin-5-yl)-2-(prop-2-enylamino)phenyl]-1-iminopropan-2-one.
| Compound Name | 1-[3-(fluoromethyl)-5-(2-methylpyrimidin-5-yl)-2-(prop-2-enylamino)phenyl]-1-iminopropan-2-one |
|---|---|
| PubChem CID | 166992004 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[3-(fluoromethyl)-5-(2-methylpyrimidin-5-yl)-2-(prop-2-enylamino)phenyl]-1-iminopropan-2-one |
| SMILES | [H]/N=C(\C(C)=O)c1cc(-c2cnc(C)nc2)cc(CF)c1NCC=C |
| InChI | InChI=1S/C18H19FN4O/c1-4-5-21-18-14(8-19)6-13(7-16(18)17(20)11(2)24)15-9-22-12(3)23-10-15/h4,6-7,9-10,20-21H,1,5,8H2,2-3H3/b20-17+ |
| InChIKey | MXVDDZPLZPDDCI-LVZFUZTISA-N |
| XLogP | 3.48 |
| TPSA | 78.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|