C17H20N4O3 — CID 168939183
methanol;2-[4-(2-methylpyrimidin-5-yl)-2-(2-oxopropanimidoyl)anilino]acetaldehyde (PubChem CID 168939183) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is methanol;2-[4-(2-methylpyrimidin-5-yl)-2-(2-oxopropanimidoyl)anilino]acetaldehyde.
| Compound Name | methanol;2-[4-(2-methylpyrimidin-5-yl)-2-(2-oxopropanimidoyl)anilino]acetaldehyde |
|---|---|
| PubChem CID | 168939183 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | methanol;2-[4-(2-methylpyrimidin-5-yl)-2-(2-oxopropanimidoyl)anilino]acetaldehyde |
| SMILES | CO.[H]/N=C(\C(C)=O)c1cc(-c2cnc(C)nc2)ccc1NCC=O |
| InChI | InChI=1S/C16H16N4O2.CH4O/c1-10(22)16(17)14-7-12(3-4-15(14)18-5-6-21)13-8-19-11(2)20-9-13;1-2/h3-4,6-9,17-18H,5H2,1-2H3;2H,1H3/b17-16+; |
| InChIKey | JUGHBQNBYBBXPC-CMBBICFISA-N |
| XLogP | 1.63 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|