C13H13FN2O4 — CID 166993665
2-(5-fluoro-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-5-oxopentanamide (PubChem CID 166993665) has the molecular formula C13H13FN2O4 and a molecular weight of 280.25 g/mol. Its IUPAC name is 2-(5-fluoro-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-5-oxopentanamide.
| Compound Name | 2-(5-fluoro-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-5-oxopentanamide |
|---|---|
| PubChem CID | 166993665 |
| Molecular Formula | C13H13FN2O4 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(5-fluoro-1,3-dioxo-3a,4-dihydroisoindol-2-yl)-5-oxopentanamide |
| SMILES | NC(=O)C(CCC=O)N1C(=O)C2=CC=C(F)CC2C1=O |
| InChI | InChI=1S/C13H13FN2O4/c14-7-3-4-8-9(6-7)13(20)16(12(8)19)10(11(15)18)2-1-5-17/h3-5,9-10H,1-2,6H2,(H2,15,18) |
| InChIKey | IOTXATDQWJFSDN-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|