C17H20N2O2 — CID 166993825
tert-butyl 3-cyclopropyl-4-phenylpyrazole-1-carboxylate (PubChem CID 166993825) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is tert-butyl 3-cyclopropyl-4-phenylpyrazole-1-carboxylate.
| Compound Name | tert-butyl 3-cyclopropyl-4-phenylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 166993825 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | tert-butyl 3-cyclopropyl-4-phenylpyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2ccccc2)c(C2CC2)n1 |
| InChI | InChI=1S/C17H20N2O2/c1-17(2,3)21-16(20)19-11-14(12-7-5-4-6-8-12)15(18-19)13-9-10-13/h4-8,11,13H,9-10H2,1-3H3 |
| InChIKey | LURXQNRAYOUZCX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |