C33H28O — CID 166995728
2-[3'-[(1Z)-buta-1,3-dienyl]-2',4',4'-trimethylspiro[fluorene-9,1'-naphthalene]-3-yl]furan (PubChem CID 166995728) has the molecular formula C33H28O and a molecular weight of 440.59 g/mol. Its IUPAC name is 2-[3'-[(1Z)-buta-1,3-dienyl]-2',4',4'-trimethylspiro[fluorene-9,1'-naphthalene]-3-yl]furan.
| Compound Name | 2-[3'-[(1Z)-buta-1,3-dienyl]-2',4',4'-trimethylspiro[fluorene-9,1'-naphthalene]-3-yl]furan |
|---|---|
| PubChem CID | 166995728 |
| Molecular Formula | C33H28O |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[3'-[(1Z)-buta-1,3-dienyl]-2',4',4'-trimethylspiro[fluorene-9,1'-naphthalene]-3-yl]furan |
| SMILES | C=C/C=C\C1=C(C)C2(c3ccccc3-c3cc(-c4ccco4)ccc32)c2ccccc2C1(C)C |
| InChI | InChI=1S/C33H28O/c1-5-6-13-26-22(2)33(30-16-10-9-15-29(30)32(26,3)4)27-14-8-7-12-24(27)25-21-23(18-19-28(25)33)31-17-11-20-34-31/h5-21H,1H2,2-4H3/b13-6- |
| InChIKey | XAWPGPLCBUMTBO-MLPAPPSSSA-N |
| XLogP | 8.61 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|