C18H25NO6 — CID 166996187
N-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yl]-4-(oxiran-2-ylmethoxy)aniline (PubChem CID 166996187) has the molecular formula C18H25NO6 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yl]-4-(oxiran-2-ylmethoxy)aniline.
| Compound Name | N-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yl]-4-(oxiran-2-ylmethoxy)aniline |
|---|---|
| PubChem CID | 166996187 |
| Molecular Formula | C18H25NO6 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[1,3-bis(oxiran-2-ylmethoxy)propan-2-yl]-4-(oxiran-2-ylmethoxy)aniline |
| SMILES | c1cc(OCC2CO2)ccc1NC(COCC1CO1)COCC1CO1 |
| InChI | InChI=1S/C18H25NO6/c1-3-15(22-11-18-12-25-18)4-2-13(1)19-14(5-20-7-16-9-23-16)6-21-8-17-10-24-17/h1-4,14,16-19H,5-12H2 |
| InChIKey | TVDKTQCWRFQOSO-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|