C34H39N5O5 — CID 166996864
5-[[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethylanilino]methyl]cyclohexyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 166996864) has the molecular formula C34H39N5O5 and a molecular weight of 597.72 g/mol. Its IUPAC name is 5-[[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethylanilino]methyl]cyclohexyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 5-[[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethylanilino]methyl]cyclohexyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 166996864 |
| Molecular Formula | C34H39N5O5 |
| Molecular Weight | 597.72 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | 5-[[4-[[5-(3,5-dimethyl-1,2-oxazol-4-yl)-N,2-dimethylanilino]methyl]cyclohexyl]methylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | Cc1ccc(-c2c(C)noc2C)cc1N(C)CC1CCC(CNc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C34H39N5O5/c1-19-5-10-24(31-20(2)37-44-21(31)3)15-29(19)38(4)18-23-8-6-22(7-9-23)17-35-25-11-12-26-27(16-25)34(43)39(33(26)42)28-13-14-30(40)36-32(28)41/h5,10-12,15-16,22-23,28,35H,6-9,13-14,17-18H2,1-4H3,(H,36,40,41) |
| InChIKey | PGNYQGILTOCCGB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 124.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.72 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|