About (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol
(Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol (PubChem CID 166998489) has the molecular formula C14H29NO
and a molecular weight of 227.39 g/mol. Its IUPAC name is (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol.
Molecular Properties
| Compound Name | (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol |
| PubChem CID | 166998489 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol |
| SMILES | CCNCC(O)C(C)CC/C=C(/C)C(C)C |
| InChI | InChI=1S/C14H29NO/c1-6-15-10-14(16)13(5)9-7-8-12(4)11(2)3/h8,11,13-16H,6-7,9-10H2,1-5H3/b12-8- |
| InChIKey | XFPAODMXEXOAJE-WQLSENKSSA-N |
| XLogP | 2.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol?
The IUPAC name of (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol (CID 166998489) is (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol.
What is the SMILES notation for (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol?
The canonical SMILES for (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol is CCNCC(O)C(C)CC/C=C(/C)C(C)C.
What is the InChIKey of (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol?
The InChIKey is XFPAODMXEXOAJE-WQLSENKSSA-N. The full InChI is InChI=1S/C14H29NO/c1-6-15-10-14(16)13(5)9-7-8-12(4)11(2)3/h8,11,13-16H,6-7,9-10H2,1-5H3/b12-8-.
What are the key properties of (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol?
(Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol has a molecular weight of 227.39 g/mol, XLogP of 2.98, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-(ethylamino)-3,7,8-trimethylnon-6-en-2-ol is sourced from PubChem (CID 166998489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).