C13H27NO2 — CID 19928727
3,7-dimethyl-2-(propylamino)oct-6-ene-1,3-diol (PubChem CID 19928727) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is 3,7-dimethyl-2-(propylamino)oct-6-ene-1,3-diol.
| Compound Name | 3,7-dimethyl-2-(propylamino)oct-6-ene-1,3-diol |
|---|---|
| PubChem CID | 19928727 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 3,7-dimethyl-2-(propylamino)oct-6-ene-1,3-diol |
| SMILES | CCCNC(CO)C(C)(O)CCC=C(C)C |
| InChI | InChI=1S/C13H27NO2/c1-5-9-14-12(10-15)13(4,16)8-6-7-11(2)3/h7,12,14-16H,5-6,8-10H2,1-4H3 |
| InChIKey | FNHJXTBQRYLFJT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|