C23H25ClO3 — CID 166999085
2-[(2S)-7-[(2-chlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]prop-2-enal (PubChem CID 166999085) has the molecular formula C23H25ClO3 and a molecular weight of 384.90 g/mol. Its IUPAC name is 2-[(2S)-7-[(2-chlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]prop-2-enal.
| Compound Name | 2-[(2S)-7-[(2-chlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]prop-2-enal |
|---|---|
| PubChem CID | 166999085 |
| Molecular Formula | C23H25ClO3 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-[(2S)-7-[(2-chlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-1,2,3,4-tetrahydronaphthalen-2-yl]prop-2-enal |
| SMILES | C=C(C=O)[C@@H]1CCc2c(C)cc(OCc3ccccc3Cl)c(C)c2C1OC |
| InChI | InChI=1S/C23H25ClO3/c1-14-11-21(27-13-17-7-5-6-8-20(17)24)16(3)22-18(14)9-10-19(15(2)12-25)23(22)26-4/h5-8,11-12,19,23H,2,9-10,13H2,1,3-4H3/t19-,23?/m0/s1 |
| InChIKey | YHOACNAQCWEOQC-HSTJUUNISA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|