C23H25BrO4 — CID 137409914
(3aS,9bR)-8-[(2-bromophenyl)methoxy]-3-(methoxymethyl)-6,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one (PubChem CID 137409914) has the molecular formula C23H25BrO4 and a molecular weight of 445.35 g/mol. Its IUPAC name is (3aS,9bR)-8-[(2-bromophenyl)methoxy]-3-(methoxymethyl)-6,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one.
| Compound Name | (3aS,9bR)-8-[(2-bromophenyl)methoxy]-3-(methoxymethyl)-6,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 137409914 |
| Molecular Formula | C23H25BrO4 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (3aS,9bR)-8-[(2-bromophenyl)methoxy]-3-(methoxymethyl)-6,9-dimethyl-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-2-one |
| SMILES | COCC1C(=O)O[C@H]2c3c(C)c(OCc4ccccc4Br)cc(C)c3CC[C@@H]12 |
| InChI | InChI=1S/C23H25BrO4/c1-13-10-20(27-11-15-6-4-5-7-19(15)24)14(2)21-16(13)8-9-17-18(12-26-3)23(25)28-22(17)21/h4-7,10,17-18,22H,8-9,11-12H2,1-3H3/t17-,18?,22+/m0/s1 |
| InChIKey | IACPYESVQAFSSQ-UMJFLEMOSA-N |
| XLogP | 5.07 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |