C60H112N4O12 — CID 167002377
octyl 3-[[3-[2-[4-[2-[3-[bis(3-octoxy-3-oxopropyl)amino]propanoyloxy]ethyl]-2,5-dimethylpiperazin-1-yl]ethoxy]-3-oxopropyl]-(3-octoxy-3-oxopropyl)amino]propanoate (PubChem CID 167002377) has the molecular formula C60H112N4O12 and a molecular weight of 1081.57 g/mol. Its IUPAC name is octyl 3-[[3-[2-[4-[2-[3-[bis(3-octoxy-3-oxopropyl)amino]propanoyloxy]ethyl]-2,5-dimethylpiperazin-1-yl]ethoxy]-3-oxopropyl]-(3-octoxy-3-oxopropyl)amino]propanoate.
| Compound Name | octyl 3-[[3-[2-[4-[2-[3-[bis(3-octoxy-3-oxopropyl)amino]propanoyloxy]ethyl]-2,5-dimethylpiperazin-1-yl]ethoxy]-3-oxopropyl]-(3-octoxy-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 167002377 |
| Molecular Formula | C60H112N4O12 |
| Molecular Weight | 1081.57 g/mol |
| Exact Mass | 1080.83 |
| IUPAC Name | octyl 3-[[3-[2-[4-[2-[3-[bis(3-octoxy-3-oxopropyl)amino]propanoyloxy]ethyl]-2,5-dimethylpiperazin-1-yl]ethoxy]-3-oxopropyl]-(3-octoxy-3-oxopropyl)amino]propanoate |
| SMILES | CCCCCCCCOC(=O)CCN(CCC(=O)OCCCCCCCC)CCC(=O)OCCN1CC(C)N(CCOC(=O)CCN(CCC(=O)OCCCCCCCC)CCC(=O)OCCCCCCCC)CC1C |
| InChI | InChI=1S/C60H112N4O12/c1-7-11-15-19-23-27-45-71-55(65)31-37-61(38-32-56(66)72-46-28-24-20-16-12-8-2)41-35-59(69)75-49-43-63-51-54(6)64(52-53(63)5)44-50-76-60(70)36-42-62(39-33-57(67)73-47-29-25-21-17-13-9-3)40-34-58(68)74-48-30-26-22-18-14-10-4/h53-54H,7-52H2,1-6H3 |
| InChIKey | KATHLJNFRYVNPW-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 170.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.57 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|