C20H23ClN2OS — CID 167004367
2-chloro-9-ethyl-6,6-dimethyl-9-phenyl-4,5,7,9a-tetrahydro-3aH-[1,3]thiazolo[4,5-b]quinolin-8-one (PubChem CID 167004367) has the molecular formula C20H23ClN2OS and a molecular weight of 374.94 g/mol. Its IUPAC name is 2-chloro-9-ethyl-6,6-dimethyl-9-phenyl-4,5,7,9a-tetrahydro-3aH-[1,3]thiazolo[4,5-b]quinolin-8-one.
| Compound Name | 2-chloro-9-ethyl-6,6-dimethyl-9-phenyl-4,5,7,9a-tetrahydro-3aH-[1,3]thiazolo[4,5-b]quinolin-8-one |
|---|---|
| PubChem CID | 167004367 |
| Molecular Formula | C20H23ClN2OS |
| Molecular Weight | 374.94 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-chloro-9-ethyl-6,6-dimethyl-9-phenyl-4,5,7,9a-tetrahydro-3aH-[1,3]thiazolo[4,5-b]quinolin-8-one |
| SMILES | CCC1(c2ccccc2)C2=C(CC(C)(C)CC2=O)NC2N=C(Cl)SC21 |
| InChI | InChI=1S/C20H23ClN2OS/c1-4-20(12-8-6-5-7-9-12)15-13(10-19(2,3)11-14(15)24)22-17-16(20)25-18(21)23-17/h5-9,16-17,22H,4,10-11H2,1-3H3 |
| InChIKey | NPXPTIGCWGSEJY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.94 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |