C26H27N3O — CID 167009420
6-methyl-N-[3-[4-[4-(methylideneamino)-3-[(Z)-prop-1-enyl]phenyl]phenyl]propyl]pyridine-3-carboxamide (PubChem CID 167009420) has the molecular formula C26H27N3O and a molecular weight of 397.52 g/mol. Its IUPAC name is 6-methyl-N-[3-[4-[4-(methylideneamino)-3-[(Z)-prop-1-enyl]phenyl]phenyl]propyl]pyridine-3-carboxamide.
| Compound Name | 6-methyl-N-[3-[4-[4-(methylideneamino)-3-[(Z)-prop-1-enyl]phenyl]phenyl]propyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167009420 |
| Molecular Formula | C26H27N3O |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.22 |
| IUPAC Name | 6-methyl-N-[3-[4-[4-(methylideneamino)-3-[(Z)-prop-1-enyl]phenyl]phenyl]propyl]pyridine-3-carboxamide |
| SMILES | C=Nc1ccc(-c2ccc(CCCNC(=O)c3ccc(C)nc3)cc2)cc1/C=C\C |
| InChI | InChI=1S/C26H27N3O/c1-4-6-23-17-22(14-15-25(23)27-3)21-12-9-20(10-13-21)7-5-16-28-26(30)24-11-8-19(2)29-18-24/h4,6,8-15,17-18H,3,5,7,16H2,1-2H3,(H,28,30)/b6-4- |
| InChIKey | QAELSZLAWNWORD-XQRVVYSFSA-N |
| XLogP | 5.78 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|