C13H20N2O — CID 178011431
N-[(E)-but-2-enyl]-6-methylpyridine-3-carboxamide;ethane (PubChem CID 178011431) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-6-methylpyridine-3-carboxamide;ethane.
| Compound Name | N-[(E)-but-2-enyl]-6-methylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 178011431 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-[(E)-but-2-enyl]-6-methylpyridine-3-carboxamide;ethane |
| SMILES | C/C=C/CNC(=O)c1ccc(C)nc1.CC |
| InChI | InChI=1S/C11H14N2O.C2H6/c1-3-4-7-12-11(14)10-6-5-9(2)13-8-10;1-2/h3-6,8H,7H2,1-2H3,(H,12,14);1-2H3/b4-3+; |
| InChIKey | QRVHBXHKAMGQMJ-BJILWQEISA-N |
| XLogP | 2.72 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|