C11H12S — CID 167009445
3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene (PubChem CID 167009445) has the molecular formula C11H12S and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene.
| Compound Name | 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene |
|---|---|
| PubChem CID | 167009445 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene |
| SMILES | C=C(/C=C\C)/C=C/c1ccsc1 |
| InChI | InChI=1S/C11H12S/c1-3-4-10(2)5-6-11-7-8-12-9-11/h3-9H,2H2,1H3/b4-3-,6-5+ |
| InChIKey | CXOQTCNLIASTBI-DNVGVPOPSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|