About 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene
3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene (PubChem CID 167009445) has the molecular formula C11H12S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene.
Molecular Properties
| Compound Name | 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene |
| PubChem CID | 167009445 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene |
| SMILES | C=C(/C=C\C)/C=C/c1ccsc1 |
| InChI | InChI=1S/C11H12S/c1-3-4-10(2)5-6-11-7-8-12-9-11/h3-9H,2H2,1H3/b4-3-,6-5+ |
| InChIKey | CXOQTCNLIASTBI-DNVGVPOPSA-N |
| XLogP | 3.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene?
The IUPAC name of 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene (CID 167009445) is 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene.
What is the SMILES notation for 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene?
The canonical SMILES for 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene is C=C(/C=C\C)/C=C/c1ccsc1.
What is the InChIKey of 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene?
The InChIKey is CXOQTCNLIASTBI-DNVGVPOPSA-N. The full InChI is InChI=1S/C11H12S/c1-3-4-10(2)5-6-11-7-8-12-9-11/h3-9H,2H2,1H3/b4-3-,6-5+.
What are the key properties of 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene?
3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene has a molecular weight of 176.28 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1E,4Z)-3-methylidenehexa-1,4-dienyl]thiophene is sourced from PubChem (CID 167009445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).