C10H12S — CID 18954556
3-[(1E)-4-methylpenta-1,4-dienyl]thiophene (PubChem CID 18954556) has the molecular formula C10H12S and a molecular weight of 164.27 g/mol. Its IUPAC name is 3-[(1E)-4-methylpenta-1,4-dienyl]thiophene.
| Compound Name | 3-[(1E)-4-methylpenta-1,4-dienyl]thiophene |
|---|---|
| PubChem CID | 18954556 |
| Molecular Formula | C10H12S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 3-[(1E)-4-methylpenta-1,4-dienyl]thiophene |
| SMILES | C=C(C)C/C=C/c1ccsc1 |
| InChI | InChI=1S/C10H12S/c1-9(2)4-3-5-10-6-7-11-8-10/h3,5-8H,1,4H2,2H3/b5-3+ |
| InChIKey | OKONOWSYEZBVFT-HWKANZROSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|