About (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine
(E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine (PubChem CID 20603574) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine.
Analyze (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
The IUPAC name of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine (CID 20603574) is (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine.
What is the SMILES notation for (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
The canonical SMILES for (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine is CN(C)C/C=C/c1ccsc1.
What is the InChIKey of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
The InChIKey is WZNIPCXPHYBNBD-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H13NS/c1-10(2)6-3-4-9-5-7-11-8-9/h3-5,7-8H,6H2,1-2H3/b4-3+.
What are the key properties of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
(E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine has a molecular weight of 167.28 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine is sourced from PubChem (CID 20603574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).