About (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine
(E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine (PubChem CID 20603574) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine |
| PubChem CID | 20603574 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine |
| SMILES | CN(C)C/C=C/c1ccsc1 |
| InChI | InChI=1S/C9H13NS/c1-10(2)6-3-4-9-5-7-11-8-9/h3-5,7-8H,6H2,1-2H3/b4-3+ |
| InChIKey | WZNIPCXPHYBNBD-ONEGZZNKSA-N |
| XLogP | 2.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
The IUPAC name of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine (CID 20603574) is (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine.
What is the SMILES notation for (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
The canonical SMILES for (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine is CN(C)C/C=C/c1ccsc1.
What is the InChIKey of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
The InChIKey is WZNIPCXPHYBNBD-ONEGZZNKSA-N. The full InChI is InChI=1S/C9H13NS/c1-10(2)6-3-4-9-5-7-11-8-9/h3-5,7-8H,6H2,1-2H3/b4-3+.
What are the key properties of (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine?
(E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine has a molecular weight of 167.28 g/mol, XLogP of 2.32, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-3-thiophen-3-ylprop-2-en-1-amine is sourced from PubChem (CID 20603574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).