About N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde
N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde (PubChem CID 169135569) has the molecular formula C10H17NOS
and a molecular weight of 199.32 g/mol. Its IUPAC name is N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde.
Molecular Properties
| Compound Name | N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde |
| PubChem CID | 169135569 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde |
| SMILES | CCN(C)CC.O=Cc1ccsc1 |
| InChI | InChI=1S/C5H13N.C5H4OS/c1-4-6(3)5-2;6-3-5-1-2-7-4-5/h4-5H2,1-3H3;1-4H |
| InChIKey | VOQDIPQLACLXPI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde?
The IUPAC name of N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde (CID 169135569) is N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde.
What is the SMILES notation for N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde?
The canonical SMILES for N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde is CCN(C)CC.O=Cc1ccsc1.
What is the InChIKey of N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde?
The InChIKey is VOQDIPQLACLXPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C5H4OS/c1-4-6(3)5-2;6-3-5-1-2-7-4-5/h4-5H2,1-3H3;1-4H.
What are the key properties of N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde?
N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde has a molecular weight of 199.32 g/mol, XLogP of 2.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methylethanamine;thiophene-3-carbaldehyde is sourced from PubChem (CID 169135569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).