About thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine
thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine (PubChem CID 161014446) has the molecular formula C11H13NOS2
and a molecular weight of 239.37 g/mol. Its IUPAC name is thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine.
Molecular Properties
| Compound Name | thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine |
| PubChem CID | 161014446 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine |
| SMILES | CC(N)c1ccsc1.O=Cc1ccsc1 |
| InChI | InChI=1S/C6H9NS.C5H4OS/c1-5(7)6-2-3-8-4-6;6-3-5-1-2-7-4-5/h2-5H,7H2,1H3;1-4H |
| InChIKey | TXNSZEFXCQVGFV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine?
The IUPAC name of thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine (CID 161014446) is thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine.
What is the SMILES notation for thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine?
The canonical SMILES for thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine is CC(N)c1ccsc1.O=Cc1ccsc1.
What is the InChIKey of thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine?
The InChIKey is TXNSZEFXCQVGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NS.C5H4OS/c1-5(7)6-2-3-8-4-6;6-3-5-1-2-7-4-5/h2-5H,7H2,1H3;1-4H.
What are the key properties of thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine?
thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine has a molecular weight of 239.37 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for thiophene-3-carbaldehyde;1-thiophen-3-ylethanamine is sourced from PubChem (CID 161014446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).