C17H18O2S — CID 19020191
methyl (3E,5E,7E,9E,11E)-12-thiophen-3-yldodeca-3,5,7,9,11-pentaenoate (PubChem CID 19020191) has the molecular formula C17H18O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is methyl (3E,5E,7E,9E,11E)-12-thiophen-3-yldodeca-3,5,7,9,11-pentaenoate.
| Compound Name | methyl (3E,5E,7E,9E,11E)-12-thiophen-3-yldodeca-3,5,7,9,11-pentaenoate |
|---|---|
| PubChem CID | 19020191 |
| Molecular Formula | C17H18O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | methyl (3E,5E,7E,9E,11E)-12-thiophen-3-yldodeca-3,5,7,9,11-pentaenoate |
| SMILES | COC(=O)C/C=C/C=C/C=C/C=C/C=C/c1ccsc1 |
| InChI | InChI=1S/C17H18O2S/c1-19-17(18)12-10-8-6-4-2-3-5-7-9-11-16-13-14-20-15-16/h2-11,13-15H,12H2,1H3/b3-2+,6-4+,7-5+,10-8+,11-9+ |
| InChIKey | ZAQBXQLAVPPRJD-JBVPIKLJSA-N |
| XLogP | 4.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|