C34H45N9 — CID 167014585
2-N-[2,5-diethyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(2,3-dihydro-1H-indol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 167014585) has the molecular formula C34H45N9 and a molecular weight of 579.80 g/mol. Its IUPAC name is 2-N-[2,5-diethyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(2,3-dihydro-1H-indol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2,5-diethyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(2,3-dihydro-1H-indol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 167014585 |
| Molecular Formula | C34H45N9 |
| Molecular Weight | 579.80 g/mol |
| Exact Mass | 579.38 |
| IUPAC Name | 2-N-[2,5-diethyl-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]phenyl]-4-N-(2,3-dihydro-1H-indol-7-yl)-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | CCc1cc(N2CCC(N3CCN(C)CC3)CC2)c(CC)cc1Nc1nc(Nc2cccc3c2NCC3)c2cc[nH]c2n1 |
| InChI | InChI=1S/C34H45N9/c1-4-23-22-30(43-15-11-26(12-16-43)42-19-17-41(3)18-20-42)24(5-2)21-29(23)38-34-39-32-27(10-14-36-32)33(40-34)37-28-8-6-7-25-9-13-35-31(25)28/h6-8,10,14,21-22,26,35H,4-5,9,11-13,15-20H2,1-3H3,(H3,36,37,38,39,40) |
| InChIKey | OXNFDAHJQPEOLU-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.80 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|