C11H11Cl2IO — CID 167016314
2-tert-butyl-4,5-dichlorobenzoyl iodide (PubChem CID 167016314) has the molecular formula C11H11Cl2IO and a molecular weight of 357.02 g/mol. Its IUPAC name is 2-tert-butyl-4,5-dichlorobenzoyl iodide.
| Compound Name | 2-tert-butyl-4,5-dichlorobenzoyl iodide |
|---|---|
| PubChem CID | 167016314 |
| Molecular Formula | C11H11Cl2IO |
| Molecular Weight | 357.02 g/mol |
| Exact Mass | 355.92 |
| IUPAC Name | 2-tert-butyl-4,5-dichlorobenzoyl iodide |
| SMILES | CC(C)(C)c1cc(Cl)c(Cl)cc1C(=O)I |
| InChI | InChI=1S/C11H11Cl2IO/c1-11(2,3)7-5-9(13)8(12)4-6(7)10(14)15/h4-5H,1-3H3 |
| InChIKey | CQBXOIKRPVHZRS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.02 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|