C37H46F3N7O4 — CID 167018441
5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-[4-[3-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]propoxy]anilino]benzamide (PubChem CID 167018441) has the molecular formula C37H46F3N7O4 and a molecular weight of 709.81 g/mol. Its IUPAC name is 5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-[4-[3-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]propoxy]anilino]benzamide.
| Compound Name | 5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-[4-[3-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]propoxy]anilino]benzamide |
|---|---|
| PubChem CID | 167018441 |
| Molecular Formula | C37H46F3N7O4 |
| Molecular Weight | 709.81 g/mol |
| Exact Mass | 709.36 |
| IUPAC Name | 5-[6,6-dimethyl-4-oxo-3-(trifluoromethyl)-5,7-dihydroindazol-1-yl]-2-[4-[3-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]propoxy]anilino]benzamide |
| SMILES | CC1(C)CC(=O)c2c(C(F)(F)F)nn(-c3ccc(Nc4ccc(OCCCN5CCN(CC6CCN(C=O)CC6)CC5)cc4)c(C(N)=O)c3)c2C1 |
| InChI | InChI=1S/C37H46F3N7O4/c1-36(2)21-31-33(32(49)22-36)34(37(38,39)40)43-47(31)27-6-9-30(29(20-27)35(41)50)42-26-4-7-28(8-5-26)51-19-3-12-44-15-17-45(18-16-44)23-25-10-13-46(24-48)14-11-25/h4-9,20,24-25,42H,3,10-19,21-23H2,1-2H3,(H2,41,50) |
| InChIKey | CKOVZWBWBXQIAY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 126.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|