C22H17F2N3O2S2 — CID 167018560
4-fluoro-6-(3-fluoroazetidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfanyl-1-benzofuran-2-carboxamide (PubChem CID 167018560) has the molecular formula C22H17F2N3O2S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-fluoro-6-(3-fluoroazetidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfanyl-1-benzofuran-2-carboxamide.
| Compound Name | 4-fluoro-6-(3-fluoroazetidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfanyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 167018560 |
| Molecular Formula | C22H17F2N3O2S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 4-fluoro-6-(3-fluoroazetidin-1-yl)-N-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]sulfanyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1nc(-c2ccc(SNC(=O)c3cc4c(F)cc(N5CC(F)C5)cc4o3)cc2)cs1 |
| InChI | InChI=1S/C22H17F2N3O2S2/c1-12-25-19(11-30-12)13-2-4-16(5-3-13)31-26-22(28)21-8-17-18(24)6-15(7-20(17)29-21)27-9-14(23)10-27/h2-8,11,14H,9-10H2,1H3,(H,26,28) |
| InChIKey | GZDHQVZHROBKIX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|